C20H17ClN2O5 — CID 118877871
(E)-2-[4-(5-chloro-2-cyanophenyl)-5-methoxy-2-oxo-1-pyridinyl]-3-(3-methyloxetan-3-yl)prop-2-enoic acid (PubChem CID 118877871) has the molecular formula C20H17ClN2O5 and a molecular weight of 400.82 g/mol. Its IUPAC name is (E)-2-[4-(5-chloro-2-cyanophenyl)-5-methoxy-2-oxo-1-pyridinyl]-3-(3-methyloxetan-3-yl)prop-2-enoic acid.
| Compound Name | (E)-2-[4-(5-chloro-2-cyanophenyl)-5-methoxy-2-oxo-1-pyridinyl]-3-(3-methyloxetan-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 118877871 |
| Molecular Formula | C20H17ClN2O5 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (E)-2-[4-(5-chloro-2-cyanophenyl)-5-methoxy-2-oxo-1-pyridinyl]-3-(3-methyloxetan-3-yl)prop-2-enoic acid |
| SMILES | COc1cn(/C(=C/C2(C)COC2)C(=O)O)c(=O)cc1-c1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C20H17ClN2O5/c1-20(10-28-11-20)7-16(19(25)26)23-9-17(27-2)15(6-18(23)24)14-5-13(21)4-3-12(14)8-22/h3-7,9H,10-11H2,1-2H3,(H,25,26)/b16-7+ |
| InChIKey | YOBISSDDZLRENO-FRKPEAEDSA-N |
| XLogP | 3.01 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|