About [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate
[5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate (PubChem CID 118878643) has the molecular formula C26H41F3O6S
and a molecular weight of 538.67 g/mol. Its IUPAC name is [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate.
Molecular Properties
| Compound Name | [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate |
| PubChem CID | 118878643 |
| Molecular Formula | C26H41F3O6S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate |
| SMILES | CCCCCCCCC/C=C\CCCCCCCC(=O)OCc1ccc(COS(=O)(=O)C(F)(F)F)o1 |
| InChI | InChI=1S/C26H41F3O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25(30)33-21-23-19-20-24(35-23)22-34-36(31,32)26(27,28)29/h10-11,19-20H,2-9,12-18,21-22H2,1H3/b11-10- |
| InChIKey | YQQUJIGJHVZSFX-KHPPLWFESA-N |
| XLogP | 8.12 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate?
The IUPAC name of [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate (CID 118878643) is [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate.
What is the SMILES notation for [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate?
The canonical SMILES for [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate is CCCCCCCCC/C=C\CCCCCCCC(=O)OCc1ccc(COS(=O)(=O)C(F)(F)F)o1.
What is the InChIKey of [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate?
The InChIKey is YQQUJIGJHVZSFX-KHPPLWFESA-N. The full InChI is InChI=1S/C26H41F3O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25(30)33-21-23-19-20-24(35-23)22-34-36(31,32)26(27,28)29/h10-11,19-20H,2-9,12-18,21-22H2,1H3/b11-10-.
What are the key properties of [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate?
[5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate has a molecular weight of 538.67 g/mol, XLogP of 8.12, 21 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(trifluoromethylsulfonyloxymethyl)furan-2-yl]methyl (Z)-nonadec-9-enoate is sourced from PubChem (CID 118878643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).