C18H19Cl3N6 — CID 118878807
N'-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(4R)-6,8-dichloro-1,2,3,4-tetrahydroquinolin-4-yl]-N'-methylethane-1,2-diamine (PubChem CID 118878807) has the molecular formula C18H19Cl3N6 and a molecular weight of 425.75 g/mol. Its IUPAC name is N'-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(4R)-6,8-dichloro-1,2,3,4-tetrahydroquinolin-4-yl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(4R)-6,8-dichloro-1,2,3,4-tetrahydroquinolin-4-yl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 118878807 |
| Molecular Formula | C18H19Cl3N6 |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N'-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(4R)-6,8-dichloro-1,2,3,4-tetrahydroquinolin-4-yl]-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN[C@@H]1CCNc2c(Cl)cc(Cl)cc21)c1nc2nc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C18H19Cl3N6/c1-27(18-24-14-2-3-15(21)25-17(14)26-18)7-6-22-13-4-5-23-16-11(13)8-10(19)9-12(16)20/h2-3,8-9,13,22-23H,4-7H2,1H3,(H,24,25,26)/t13-/m1/s1 |
| InChIKey | XBDCSRQKOZIJKF-CYBMUJFWSA-N |
| XLogP | 4.50 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|