About 4-cyclopropyl-3,5-difluorobenzonitrile
4-cyclopropyl-3,5-difluorobenzonitrile (PubChem CID 118879698) has the molecular formula C10H7F2N
and a molecular weight of 179.17 g/mol. Its IUPAC name is 4-cyclopropyl-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-cyclopropyl-3,5-difluorobenzonitrile |
| PubChem CID | 118879698 |
| Molecular Formula | C10H7F2N |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 4-cyclopropyl-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(C2CC2)c(F)c1 |
| InChI | InChI=1S/C10H7F2N/c11-8-3-6(5-13)4-9(12)10(8)7-1-2-7/h3-4,7H,1-2H2 |
| InChIKey | QXOQWEJGZDSYIU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclopropyl-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-3,5-difluorobenzonitrile?
The IUPAC name of 4-cyclopropyl-3,5-difluorobenzonitrile (CID 118879698) is 4-cyclopropyl-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-cyclopropyl-3,5-difluorobenzonitrile?
The canonical SMILES for 4-cyclopropyl-3,5-difluorobenzonitrile is N#Cc1cc(F)c(C2CC2)c(F)c1.
What is the InChIKey of 4-cyclopropyl-3,5-difluorobenzonitrile?
The InChIKey is QXOQWEJGZDSYIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2N/c11-8-3-6(5-13)4-9(12)10(8)7-1-2-7/h3-4,7H,1-2H2.
What are the key properties of 4-cyclopropyl-3,5-difluorobenzonitrile?
4-cyclopropyl-3,5-difluorobenzonitrile has a molecular weight of 179.17 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-3,5-difluorobenzonitrile is sourced from PubChem (CID 118879698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).