C25H27ClN2O4 — CID 118879961
3-(4-chlorophenyl)-N-[(6R,8E)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]propanamide (PubChem CID 118879961) has the molecular formula C25H27ClN2O4 and a molecular weight of 454.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[(6R,8E)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[(6R,8E)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]propanamide |
|---|---|
| PubChem CID | 118879961 |
| Molecular Formula | C25H27ClN2O4 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[(6R,8E)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1)N[C@@H]1C/C=C/CCC(=O)OC(c2ccccc2)CNC1=O |
| InChI | InChI=1S/C25H27ClN2O4/c26-20-14-11-18(12-15-20)13-16-23(29)28-21-9-5-2-6-10-24(30)32-22(17-27-25(21)31)19-7-3-1-4-8-19/h1-5,7-8,11-12,14-15,21-22H,6,9-10,13,16-17H2,(H,27,31)(H,28,29)/b5-2+/t21-,22?/m1/s1 |
| InChIKey | CPKZXZRWYVDOKB-BQBOBUSKSA-N |
| XLogP | 3.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|