C17H22N2O5S — CID 118879980
N-[(8E,11R)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]methanesulfonamide (PubChem CID 118879980) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[(8E,11R)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]methanesulfonamide.
| Compound Name | N-[(8E,11R)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]methanesulfonamide |
|---|---|
| PubChem CID | 118879980 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[(8E,11R)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1C/C=C/CCC(=O)NC(c2ccccc2)COC1=O |
| InChI | InChI=1S/C17H22N2O5S/c1-25(22,23)19-14-10-6-3-7-11-16(20)18-15(12-24-17(14)21)13-8-4-2-5-9-13/h2-6,8-9,14-15,19H,7,10-12H2,1H3,(H,18,20)/b6-3+/t14-,15?/m1/s1 |
| InChIKey | QWVZBBNEQJSOFA-KJDDEMGPSA-N |
| XLogP | 1.04 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|