C25H27F3N6O — CID 118880161
[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(6-piperidin-1-ylimidazo[1,2-b]pyridazin-2-yl)methanone (PubChem CID 118880161) has the molecular formula C25H27F3N6O and a molecular weight of 484.53 g/mol. Its IUPAC name is [(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(6-piperidin-1-ylimidazo[1,2-b]pyridazin-2-yl)methanone.
| Compound Name | [(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(6-piperidin-1-ylimidazo[1,2-b]pyridazin-2-yl)methanone |
|---|---|
| PubChem CID | 118880161 |
| Molecular Formula | C25H27F3N6O |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | [(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(6-piperidin-1-ylimidazo[1,2-b]pyridazin-2-yl)methanone |
| SMILES | O=C(c1cn2nc(N3CCCCC3)ccc2n1)N1C[C@@H]2CN(c3ccccc3C(F)(F)F)C[C@@H]2C1 |
| InChI | InChI=1S/C25H27F3N6O/c26-25(27,28)19-6-2-3-7-21(19)32-12-17-14-33(15-18(17)13-32)24(35)20-16-34-22(29-20)8-9-23(30-34)31-10-4-1-5-11-31/h2-3,6-9,16-18H,1,4-5,10-15H2/t17-,18+ |
| InChIKey | HVBQMLSDRAUIAT-HDICACEKSA-N |
| XLogP | 3.95 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |