C20H22F3N5O — CID 118880172
(3aR,6aS)-N-(4,6-dimethylpyrimidin-2-yl)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 118880172) has the molecular formula C20H22F3N5O and a molecular weight of 405.42 g/mol. Its IUPAC name is (3aR,6aS)-N-(4,6-dimethylpyrimidin-2-yl)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-N-(4,6-dimethylpyrimidin-2-yl)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 118880172 |
| Molecular Formula | C20H22F3N5O |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (3aR,6aS)-N-(4,6-dimethylpyrimidin-2-yl)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)N2C[C@@H]3CN(c4ccccc4C(F)(F)F)C[C@@H]3C2)n1 |
| InChI | InChI=1S/C20H22F3N5O/c1-12-7-13(2)25-18(24-12)26-19(29)28-10-14-8-27(9-15(14)11-28)17-6-4-3-5-16(17)20(21,22)23/h3-7,14-15H,8-11H2,1-2H3,(H,24,25,26,29)/t14-,15+ |
| InChIKey | HWQDZFCZQFAXKD-GASCZTMLSA-N |
| XLogP | 3.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |