C28H42O4 — CID 118880237
[4-[2-methyl-1-[2-(8-tricyclo[5.2.1.02,6]decanyl)ethoxy]propoxy]phenyl] 2,2-dimethylbutanoate (PubChem CID 118880237) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is [4-[2-methyl-1-[2-(8-tricyclo[5.2.1.02,6]decanyl)ethoxy]propoxy]phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[2-methyl-1-[2-(8-tricyclo[5.2.1.02,6]decanyl)ethoxy]propoxy]phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118880237 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | [4-[2-methyl-1-[2-(8-tricyclo[5.2.1.02,6]decanyl)ethoxy]propoxy]phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(OC(OCCC2CC3CC2C2CCCC32)C(C)C)cc1 |
| InChI | InChI=1S/C28H42O4/c1-6-28(4,5)27(29)32-22-12-10-21(11-13-22)31-26(18(2)3)30-15-14-19-16-20-17-25(19)24-9-7-8-23(20)24/h10-13,18-20,23-26H,6-9,14-17H2,1-5H3 |
| InChIKey | QHBOPQGSYYELON-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|