C17H12F8O4S — CID 118880239
4-[(4-butan-2-yl-2,3,5,6-tetrafluorophenoxy)methyl]-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 118880239) has the molecular formula C17H12F8O4S and a molecular weight of 464.33 g/mol. Its IUPAC name is 4-[(4-butan-2-yl-2,3,5,6-tetrafluorophenoxy)methyl]-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[(4-butan-2-yl-2,3,5,6-tetrafluorophenoxy)methyl]-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 118880239 |
| Molecular Formula | C17H12F8O4S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 4-[(4-butan-2-yl-2,3,5,6-tetrafluorophenoxy)methyl]-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCC(C)c1c(F)c(F)c(OCc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C17H12F8O4S/c1-3-5(2)7-10(20)12(22)16(13(23)11(7)21)29-4-6-8(18)14(24)17(30(26,27)28)15(25)9(6)19/h5H,3-4H2,1-2H3,(H,26,27,28) |
| InChIKey | QYGQORRWSKUDSE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|