About 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid
2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid (PubChem CID 118880260) has the molecular formula C11H17NO5
and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid.
Molecular Properties
| Compound Name | 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid |
| PubChem CID | 118880260 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid |
| SMILES | CCC(C)(C)C(=O)OCCOC(C#N)C(=O)O |
| InChI | InChI=1S/C11H17NO5/c1-4-11(2,3)10(15)17-6-5-16-8(7-12)9(13)14/h8H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | VYUNMUDZMHYXQY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid?
The IUPAC name of 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid (CID 118880260) is 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid.
What is the SMILES notation for 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid?
The canonical SMILES for 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid is CCC(C)(C)C(=O)OCCOC(C#N)C(=O)O.
What is the InChIKey of 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid?
The InChIKey is VYUNMUDZMHYXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO5/c1-4-11(2,3)10(15)17-6-5-16-8(7-12)9(13)14/h8H,4-6H2,1-3H3,(H,13,14).
What are the key properties of 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid?
2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid has a molecular weight of 243.26 g/mol, XLogP of 0.96, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-2-[2-(2,2-dimethylbutanoyloxy)ethoxy]acetic acid is sourced from PubChem (CID 118880260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).