About 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine
1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine (PubChem CID 118881013) has the molecular formula C17H17NOS
and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine.
Molecular Properties
| Compound Name | 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine |
| PubChem CID | 118881013 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine |
| SMILES | C=c1c(C)c(OC)c2c(c1C)Sc1cc(C)ccc1N=2 |
| InChI | InChI=1S/C17H17NOS/c1-9-6-7-13-14(8-9)20-17-12(4)10(2)11(3)16(19-5)15(17)18-13/h6-8H,2H2,1,3-5H3 |
| InChIKey | BPMNTPUHJUIJNB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine?
The IUPAC name of 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine (CID 118881013) is 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine.
What is the SMILES notation for 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine?
The canonical SMILES for 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine is C=c1c(C)c(OC)c2c(c1C)Sc1cc(C)ccc1N=2.
What is the InChIKey of 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine?
The InChIKey is BPMNTPUHJUIJNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NOS/c1-9-6-7-13-14(8-9)20-17-12(4)10(2)11(3)16(19-5)15(17)18-13/h6-8H,2H2,1,3-5H3.
What are the key properties of 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine?
1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine has a molecular weight of 283.40 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2,4,7-trimethyl-3-methylidenephenothiazine is sourced from PubChem (CID 118881013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).