C26H31N7O5 — CID 118881047
8-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[3-[2-hydroxy-3-(methylamino)propoxy]phenyl]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 118881047) has the molecular formula C26H31N7O5 and a molecular weight of 521.58 g/mol. Its IUPAC name is 8-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[3-[2-hydroxy-3-(methylamino)propoxy]phenyl]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[3-[2-hydroxy-3-(methylamino)propoxy]phenyl]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 118881047 |
| Molecular Formula | C26H31N7O5 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 8-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[3-[2-hydroxy-3-(methylamino)propoxy]phenyl]pyrimidin-4-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CNCC(O)COc1cccc(-c2nc(-c3c(C)noc3C)cc(N3CCC4(CC3)NC(=O)NC4=O)n2)c1 |
| InChI | InChI=1S/C26H31N7O5/c1-15-22(16(2)38-32-15)20-12-21(33-9-7-26(8-10-33)24(35)30-25(36)31-26)29-23(28-20)17-5-4-6-19(11-17)37-14-18(34)13-27-3/h4-6,11-12,18,27,34H,7-10,13-14H2,1-3H3,(H2,30,31,35,36) |
| InChIKey | OJZBGQCPZPUBSS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|