C21H30O4 — CID 118881745
[(1R,9R)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-6-methylidene-3-oxo-2-oxaspiro[4.5]decan-9-yl] acetate (PubChem CID 118881745) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [(1R,9R)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-6-methylidene-3-oxo-2-oxaspiro[4.5]decan-9-yl] acetate.
| Compound Name | [(1R,9R)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-6-methylidene-3-oxo-2-oxaspiro[4.5]decan-9-yl] acetate |
|---|---|
| PubChem CID | 118881745 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [(1R,9R)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-6-methylidene-3-oxo-2-oxaspiro[4.5]decan-9-yl] acetate |
| SMILES | C=C1CC[C@@H](OC(C)=O)CC12CC(=O)O[C@@H]2/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H30O4/c1-14(2)7-6-8-15(3)11-19-21(13-20(23)25-19)12-18(24-17(5)22)10-9-16(21)4/h7,11,18-19H,4,6,8-10,12-13H2,1-3,5H3/b15-11+/t18-,19-,21?/m1/s1 |
| InChIKey | XUVAMOFMFZGGAA-CUYTYMCOSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|