C24H14N2S2 — CID 118881856
6,13-diphenyl-5,12-dithia-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),6,8,10,13-heptaene (PubChem CID 118881856) has the molecular formula C24H14N2S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 6,13-diphenyl-5,12-dithia-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),6,8,10,13-heptaene.
| Compound Name | 6,13-diphenyl-5,12-dithia-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),6,8,10,13-heptaene |
|---|---|
| PubChem CID | 118881856 |
| Molecular Formula | C24H14N2S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 6,13-diphenyl-5,12-dithia-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),6,8,10,13-heptaene |
| SMILES | c1ccc(C2=Nc3ccc4c5c(ccc(c35)S2)N=C(c2ccccc2)S4)cc1 |
| InChI | InChI=1S/C24H14N2S2/c1-3-7-15(8-4-1)23-25-17-11-14-20-22-18(12-13-19(27-23)21(17)22)26-24(28-20)16-9-5-2-6-10-16/h1-14H |
| InChIKey | KSNRITLPFRETKO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |