C39H46N4O2 — CID 118881949
ethyl 9-[1-(3-ethyl-1-methylpyrido[3,4-b]indol-9-yl)decyl]-1-methylpyrido[3,4-b]indole-3-carboxylate (PubChem CID 118881949) has the molecular formula C39H46N4O2 and a molecular weight of 602.82 g/mol. Its IUPAC name is ethyl 9-[1-(3-ethyl-1-methylpyrido[3,4-b]indol-9-yl)decyl]-1-methylpyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 9-[1-(3-ethyl-1-methylpyrido[3,4-b]indol-9-yl)decyl]-1-methylpyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 118881949 |
| Molecular Formula | C39H46N4O2 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | ethyl 9-[1-(3-ethyl-1-methylpyrido[3,4-b]indol-9-yl)decyl]-1-methylpyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCCCCCCCCC(n1c2ccccc2c2cc(CC)nc(C)c21)n1c2ccccc2c2cc(C(=O)OCC)nc(C)c21 |
| InChI | InChI=1S/C39H46N4O2/c1-6-9-10-11-12-13-14-23-36(42-34-21-17-15-19-29(34)31-24-28(7-2)40-26(4)37(31)42)43-35-22-18-16-20-30(35)32-25-33(39(44)45-8-3)41-27(5)38(32)43/h15-22,24-25,36H,6-14,23H2,1-5H3 |
| InChIKey | RJXGWXZIKPQZPN-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|