C42H38N6O2 — CID 118881967
ethyl 9-[5-(3-ethyl-1-pyridin-3-ylpyrido[3,4-b]indol-9-yl)pentyl]-1-pyridin-3-ylpyrido[3,4-b]indole-3-carboxylate (PubChem CID 118881967) has the molecular formula C42H38N6O2 and a molecular weight of 658.81 g/mol. Its IUPAC name is ethyl 9-[5-(3-ethyl-1-pyridin-3-ylpyrido[3,4-b]indol-9-yl)pentyl]-1-pyridin-3-ylpyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 9-[5-(3-ethyl-1-pyridin-3-ylpyrido[3,4-b]indol-9-yl)pentyl]-1-pyridin-3-ylpyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 118881967 |
| Molecular Formula | C42H38N6O2 |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | ethyl 9-[5-(3-ethyl-1-pyridin-3-ylpyrido[3,4-b]indol-9-yl)pentyl]-1-pyridin-3-ylpyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c3ccccc3n(CCCCCn3c4ccccc4c4cc(CC)nc(-c5cccnc5)c43)c2c(-c2cccnc2)n1 |
| InChI | InChI=1S/C42H38N6O2/c1-3-30-24-33-31-16-6-8-18-36(31)47(40(33)38(45-30)28-14-12-20-43-26-28)22-10-5-11-23-48-37-19-9-7-17-32(37)34-25-35(42(49)50-4-2)46-39(41(34)48)29-15-13-21-44-27-29/h6-9,12-21,24-27H,3-5,10-11,22-23H2,1-2H3 |
| InChIKey | QJOGIXIMIXEMTJ-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|