C43H40N6O2 — CID 118881969
ethyl 9-[6-(3-ethyl-1-pyridin-3-ylpyrido[3,4-b]indol-9-yl)hexyl]-1-pyridin-3-ylpyrido[3,4-b]indole-3-carboxylate (PubChem CID 118881969) has the molecular formula C43H40N6O2 and a molecular weight of 672.83 g/mol. Its IUPAC name is ethyl 9-[6-(3-ethyl-1-pyridin-3-ylpyrido[3,4-b]indol-9-yl)hexyl]-1-pyridin-3-ylpyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 9-[6-(3-ethyl-1-pyridin-3-ylpyrido[3,4-b]indol-9-yl)hexyl]-1-pyridin-3-ylpyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 118881969 |
| Molecular Formula | C43H40N6O2 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.32 |
| IUPAC Name | ethyl 9-[6-(3-ethyl-1-pyridin-3-ylpyrido[3,4-b]indol-9-yl)hexyl]-1-pyridin-3-ylpyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c3ccccc3n(CCCCCCn3c4ccccc4c4cc(CC)nc(-c5cccnc5)c43)c2c(-c2cccnc2)n1 |
| InChI | InChI=1S/C43H40N6O2/c1-3-31-25-34-32-17-7-9-19-37(32)48(41(34)39(46-31)29-15-13-21-44-27-29)23-11-5-6-12-24-49-38-20-10-8-18-33(38)35-26-36(43(50)51-4-2)47-40(42(35)49)30-16-14-22-45-28-30/h7-10,13-22,25-28H,3-6,11-12,23-24H2,1-2H3 |
| InChIKey | LJDIWRQMSZIJMN-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|