C39H50N8O5 — CID 118882288
(1-methylpiperidin-4-yl)methyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 118882288) has the molecular formula C39H50N8O5 and a molecular weight of 710.88 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl)methyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | (1-methylpiperidin-4-yl)methyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 118882288 |
| Molecular Formula | C39H50N8O5 |
| Molecular Weight | 710.88 g/mol |
| Exact Mass | 710.39 |
| IUPAC Name | (1-methylpiperidin-4-yl)methyl 3-[[2-[[4-[(Z)-N'-hexoxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCCCCCOC(=O)/N=C(\N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC4CCN(C)CC4)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C39H50N8O5/c1-4-5-6-9-24-51-39(50)44-37(40)29-11-14-31(15-12-29)42-26-35-43-32-25-30(13-16-33(32)46(35)3)38(49)47(34-10-7-8-20-41-34)23-19-36(48)52-27-28-17-21-45(2)22-18-28/h7-8,10-16,20,25,28,42H,4-6,9,17-19,21-24,26-27H2,1-3H3,(H2,40,44,50) |
| InChIKey | VTFWHFGCXIHANH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 157.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.88 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|