C20H32O3 — CID 118882432
(2S)-2-[(1S,2R,4S,6R,9S,10R)-1,6,10-trimethyl-5-oxatetracyclo[7.5.0.02,6.010,12]tetradecan-4-yl]but-3-ene-1,2-diol (PubChem CID 118882432) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (2S)-2-[(1S,2R,4S,6R,9S,10R)-1,6,10-trimethyl-5-oxatetracyclo[7.5.0.02,6.010,12]tetradecan-4-yl]but-3-ene-1,2-diol.
| Compound Name | (2S)-2-[(1S,2R,4S,6R,9S,10R)-1,6,10-trimethyl-5-oxatetracyclo[7.5.0.02,6.010,12]tetradecan-4-yl]but-3-ene-1,2-diol |
|---|---|
| PubChem CID | 118882432 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (2S)-2-[(1S,2R,4S,6R,9S,10R)-1,6,10-trimethyl-5-oxatetracyclo[7.5.0.02,6.010,12]tetradecan-4-yl]but-3-ene-1,2-diol |
| SMILES | C=C[C@](O)(CO)[C@@H]1C[C@@H]2[C@@]3(C)CCC4C[C@@]4(C)[C@@H]3CC[C@@]2(C)O1 |
| InChI | InChI=1S/C20H32O3/c1-5-20(22,12-21)16-10-15-17(2)8-6-13-11-18(13,3)14(17)7-9-19(15,4)23-16/h5,13-16,21-22H,1,6-12H2,2-4H3/t13?,14-,15-,16+,17+,18-,19-,20+/m1/s1 |
| InChIKey | NMACPTAYJLRZHC-JZUVOLHPSA-N |
| XLogP | 3.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|