C23H20ClN3O4 — CID 118882476
15-(4-chlorophenyl)-5-hydroxyspiro[8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,1'-cyclopentane]-14,16-dione (PubChem CID 118882476) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is 15-(4-chlorophenyl)-5-hydroxyspiro[8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,1'-cyclopentane]-14,16-dione.
| Compound Name | 15-(4-chlorophenyl)-5-hydroxyspiro[8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,1'-cyclopentane]-14,16-dione |
|---|---|
| PubChem CID | 118882476 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 15-(4-chlorophenyl)-5-hydroxyspiro[8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,1'-cyclopentane]-14,16-dione |
| SMILES | O=c1n(-c2ccc(Cl)cc2)c(=O)n2n1CC=C1C2c2ccc(O)cc2OC12CCCC2 |
| InChI | InChI=1S/C23H20ClN3O4/c24-14-3-5-15(6-4-14)26-21(29)25-12-9-18-20(27(25)22(26)30)17-8-7-16(28)13-19(17)31-23(18)10-1-2-11-23/h3-9,13,20,28H,1-2,10-12H2 |
| InChIKey | HRPINLCWWCBXAF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|