C13H22F6N2O2 — CID 118882617
(3S,4R)-6-[bis(3,3,3-trifluoropropyl)amino]-3-hydroxy-4-methylhexanamide (PubChem CID 118882617) has the molecular formula C13H22F6N2O2 and a molecular weight of 352.32 g/mol. Its IUPAC name is (3S,4R)-6-[bis(3,3,3-trifluoropropyl)amino]-3-hydroxy-4-methylhexanamide.
| Compound Name | (3S,4R)-6-[bis(3,3,3-trifluoropropyl)amino]-3-hydroxy-4-methylhexanamide |
|---|---|
| PubChem CID | 118882617 |
| Molecular Formula | C13H22F6N2O2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (3S,4R)-6-[bis(3,3,3-trifluoropropyl)amino]-3-hydroxy-4-methylhexanamide |
| SMILES | C[C@H](CCN(CCC(F)(F)F)CCC(F)(F)F)[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C13H22F6N2O2/c1-9(10(22)8-11(20)23)2-5-21(6-3-12(14,15)16)7-4-13(17,18)19/h9-10,22H,2-8H2,1H3,(H2,20,23)/t9-,10+/m1/s1 |
| InChIKey | ORHOHDRVURZMKL-ZJUUUORDSA-N |
| XLogP | 2.46 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |