C11H18F4N2O2 — CID 118882621
(3S,4R)-3-hydroxy-4-methyl-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexanamide (PubChem CID 118882621) has the molecular formula C11H18F4N2O2 and a molecular weight of 286.27 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-4-methyl-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexanamide.
| Compound Name | (3S,4R)-3-hydroxy-4-methyl-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexanamide |
|---|---|
| PubChem CID | 118882621 |
| Molecular Formula | C11H18F4N2O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (3S,4R)-3-hydroxy-4-methyl-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexanamide |
| SMILES | C[C@H](CCN1CC(F)(F)C(F)(F)C1)[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C11H18F4N2O2/c1-7(8(18)4-9(16)19)2-3-17-5-10(12,13)11(14,15)6-17/h7-8,18H,2-6H2,1H3,(H2,16,19)/t7-,8+/m1/s1 |
| InChIKey | JXZHCDAFCIYELU-SFYZADRCSA-N |
| XLogP | 0.84 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|