About 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine
3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine (PubChem CID 118882777) has the molecular formula C12H18ClFN4
and a molecular weight of 272.75 g/mol. Its IUPAC name is 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine |
| PubChem CID | 118882777 |
| Molecular Formula | C12H18ClFN4 |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine |
| SMILES | CC1(C)CC(N)CC(Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C12H18ClFN4/c1-12(2)4-7(15)3-8(5-12)17-10-9(14)6-16-11(13)18-10/h6-8H,3-5,15H2,1-2H3,(H,16,17,18) |
| InChIKey | DBHHPKFUEBRGJI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine?
The IUPAC name of 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine (CID 118882777) is 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine.
What is the SMILES notation for 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine?
The canonical SMILES for 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine is CC1(C)CC(N)CC(Nc2nc(Cl)ncc2F)C1.
What is the InChIKey of 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine?
The InChIKey is DBHHPKFUEBRGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClFN4/c1-12(2)4-7(15)3-8(5-12)17-10-9(14)6-16-11(13)18-10/h6-8H,3-5,15H2,1-2H3,(H,16,17,18).
What are the key properties of 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine?
3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine has a molecular weight of 272.75 g/mol, XLogP of 2.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethylcyclohexane-1,3-diamine is sourced from PubChem (CID 118882777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).