C12H21NO2S — CID 118884057
[(1R,2E)-2-ethylidene-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide (PubChem CID 118884057) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is [(1R,2E)-2-ethylidene-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide.
| Compound Name | [(1R,2E)-2-ethylidene-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
|---|---|
| PubChem CID | 118884057 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | [(1R,2E)-2-ethylidene-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
| SMILES | C/C=C1\CC2CC[C@@]1(CS(N)(=O)=O)C2(C)C |
| InChI | InChI=1S/C12H21NO2S/c1-4-9-7-10-5-6-12(9,11(10,2)3)8-16(13,14)15/h4,10H,5-8H2,1-3H3,(H2,13,14,15)/b9-4+/t10?,12-/m0/s1 |
| InChIKey | NRKHRHZITGHXOL-YLIFMZQBSA-N |
| XLogP | 2.05 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|