C22H35NO6 — CID 118884064
6-ethenyl-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-4-(2-methylprop-1-enyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 118884064) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is 6-ethenyl-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-4-(2-methylprop-1-enyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 6-ethenyl-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-4-(2-methylprop-1-enyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 118884064 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 6-ethenyl-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-4-(2-methylprop-1-enyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | C=CC1CC(C=C(C)C)C2C(=O)N(CCOCCOCCOCCOC)C(=O)C12 |
| InChI | InChI=1S/C22H35NO6/c1-5-17-15-18(14-16(2)3)20-19(17)21(24)23(22(20)25)6-7-27-10-11-29-13-12-28-9-8-26-4/h5,14,17-20H,1,6-13,15H2,2-4H3 |
| InChIKey | LUACDOFEWMICNU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|