C21H18ClFN4O5S2 — CID 118884398
N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 118884398) has the molecular formula C21H18ClFN4O5S2 and a molecular weight of 524.98 g/mol. Its IUPAC name is N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118884398 |
| Molecular Formula | C21H18ClFN4O5S2 |
| Molecular Weight | 524.98 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(Cl)c1)C1(O)CCN(c2ccc(S(=O)(=O)Nc3nccs3)cc2)C1=O |
| InChI | InChI=1S/C21H18ClFN4O5S2/c22-14-9-13(10-15(23)11-14)12-25-18(28)21(30)5-7-27(19(21)29)16-1-3-17(4-2-16)34(31,32)26-20-24-6-8-33-20/h1-4,6,8-11,30H,5,7,12H2,(H,24,26)(H,25,28) |
| InChIKey | CHFLIAXPSPJVNT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.98 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|