C29H26N4O5 — CID 118884505
N-hydroxy-4-[(14-methyl-13,15-dioxo-5-phenylmethoxy-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzamide (PubChem CID 118884505) has the molecular formula C29H26N4O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is N-hydroxy-4-[(14-methyl-13,15-dioxo-5-phenylmethoxy-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzamide.
| Compound Name | N-hydroxy-4-[(14-methyl-13,15-dioxo-5-phenylmethoxy-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzamide |
|---|---|
| PubChem CID | 118884505 |
| Molecular Formula | C29H26N4O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | N-hydroxy-4-[(14-methyl-13,15-dioxo-5-phenylmethoxy-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzamide |
| SMILES | CN1C(=O)C2CN(Cc3c2c2cc(OCc4ccccc4)ccc2n3Cc2ccc(C(=O)NO)cc2)C1=O |
| InChI | InChI=1S/C29H26N4O5/c1-31-28(35)23-15-32(29(31)36)16-25-26(23)22-13-21(38-17-19-5-3-2-4-6-19)11-12-24(22)33(25)14-18-7-9-20(10-8-18)27(34)30-37/h2-13,23,37H,14-17H2,1H3,(H,30,34) |
| InChIKey | VHTGDRTYAKNAEN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|