C26H24N4O5 — CID 118884623
4-[[14-methyl-13,15-dioxo-5-[(prop-2-enoylamino)methyl]-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl]methyl]benzoic acid (PubChem CID 118884623) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 4-[[14-methyl-13,15-dioxo-5-[(prop-2-enoylamino)methyl]-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl]methyl]benzoic acid.
| Compound Name | 4-[[14-methyl-13,15-dioxo-5-[(prop-2-enoylamino)methyl]-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 118884623 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 4-[[14-methyl-13,15-dioxo-5-[(prop-2-enoylamino)methyl]-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl]methyl]benzoic acid |
| SMILES | C=CC(=O)NCc1ccc2c(c1)c1c(n2Cc2ccc(C(=O)O)cc2)CN2CC1C(=O)N(C)C2=O |
| InChI | InChI=1S/C26H24N4O5/c1-3-22(31)27-11-16-6-9-20-18(10-16)23-19-13-29(26(35)28(2)24(19)32)14-21(23)30(20)12-15-4-7-17(8-5-15)25(33)34/h3-10,19H,1,11-14H2,2H3,(H,27,31)(H,33,34) |
| InChIKey | KQMSZSHNOIQGIG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|