C23H22F2N6OS — CID 118884794
8-[3-[(4S,5S,6S)-2-amino-6-(hydroxymethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-4,5-difluoroanilino]-1,7-naphthyridine-3-carbonitrile (PubChem CID 118884794) has the molecular formula C23H22F2N6OS and a molecular weight of 468.53 g/mol. Its IUPAC name is 8-[3-[(4S,5S,6S)-2-amino-6-(hydroxymethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-4,5-difluoroanilino]-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 8-[3-[(4S,5S,6S)-2-amino-6-(hydroxymethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-4,5-difluoroanilino]-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118884794 |
| Molecular Formula | C23H22F2N6OS |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 8-[3-[(4S,5S,6S)-2-amino-6-(hydroxymethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-4,5-difluoroanilino]-1,7-naphthyridine-3-carbonitrile |
| SMILES | C[C@@H]1[C@@](C)(CO)SC(N)=N[C@]1(C)c1cc(Nc2nccc3cc(C#N)cnc23)cc(F)c1F |
| InChI | InChI=1S/C23H22F2N6OS/c1-12-22(2,11-32)33-21(27)31-23(12,3)16-7-15(8-17(24)18(16)25)30-20-19-14(4-5-28-20)6-13(9-26)10-29-19/h4-8,10,12,32H,11H2,1-3H3,(H2,27,31)(H,28,30)/t12-,22-,23+/m1/s1 |
| InChIKey | ALBBNUZLAOVQGL-SPXSEQDZSA-N |
| XLogP | 4.19 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |