C14H19F2N3OS — CID 118884795
[(4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-5H-1,3-thiazin-6-yl]methanol (PubChem CID 118884795) has the molecular formula C14H19F2N3OS and a molecular weight of 315.39 g/mol. Its IUPAC name is [(4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-5H-1,3-thiazin-6-yl]methanol.
| Compound Name | [(4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-5H-1,3-thiazin-6-yl]methanol |
|---|---|
| PubChem CID | 118884795 |
| Molecular Formula | C14H19F2N3OS |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [(4S,5S,6S)-2-amino-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-5H-1,3-thiazin-6-yl]methanol |
| SMILES | C[C@@H]1[C@@](C)(CO)SC(N)=N[C@]1(C)c1cc(N)cc(F)c1F |
| InChI | InChI=1S/C14H19F2N3OS/c1-7-13(2,6-20)21-12(18)19-14(7,3)9-4-8(17)5-10(15)11(9)16/h4-5,7,20H,6,17H2,1-3H3,(H2,18,19)/t7-,13-,14+/m1/s1 |
| InChIKey | DGNLBWDGBMITHD-FNSHAYQCSA-N |
| XLogP | 2.21 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|