C28H40F2N4O6S — CID 118884847
tert-butyl N-[(4S,6S)-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-6-(morpholine-4-carbonyl)-5H-1,3-thiazin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 118884847) has the molecular formula C28H40F2N4O6S and a molecular weight of 598.71 g/mol. Its IUPAC name is tert-butyl N-[(4S,6S)-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-6-(morpholine-4-carbonyl)-5H-1,3-thiazin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[(4S,6S)-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-6-(morpholine-4-carbonyl)-5H-1,3-thiazin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 118884847 |
| Molecular Formula | C28H40F2N4O6S |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | tert-butyl N-[(4S,6S)-4-(5-amino-2,3-difluorophenyl)-4,5,6-trimethyl-6-(morpholine-4-carbonyl)-5H-1,3-thiazin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC1[C@@](C)(C(=O)N2CCOCC2)SC(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)=N[C@]1(C)c1cc(N)cc(F)c1F |
| InChI | InChI=1S/C28H40F2N4O6S/c1-16-27(8,18-14-17(31)15-19(29)20(18)30)32-22(41-28(16,9)21(35)33-10-12-38-13-11-33)34(23(36)39-25(2,3)4)24(37)40-26(5,6)7/h14-16H,10-13,31H2,1-9H3/t16?,27-,28-/m0/s1 |
| InChIKey | IVFONRUUNHBTCB-XVZCBHAZSA-N |
| XLogP | 5.29 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|