C20H19F3N6S — CID 118885031
(4S,5S)-4-[2,3-difluoro-5-[(7-fluoropyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]-4,5,6-trimethyl-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 118885031) has the molecular formula C20H19F3N6S and a molecular weight of 432.48 g/mol. Its IUPAC name is (4S,5S)-4-[2,3-difluoro-5-[(7-fluoropyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]-4,5,6-trimethyl-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | (4S,5S)-4-[2,3-difluoro-5-[(7-fluoropyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]-4,5,6-trimethyl-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 118885031 |
| Molecular Formula | C20H19F3N6S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (4S,5S)-4-[2,3-difluoro-5-[(7-fluoropyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]-4,5,6-trimethyl-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CC1SC(N)=N[C@](C)(c2cc(Nc3ncnc4cc(F)cnc34)cc(F)c2F)[C@@H]1C |
| InChI | InChI=1S/C20H19F3N6S/c1-9-10(2)30-19(24)29-20(9,3)13-5-12(6-14(22)16(13)23)28-18-17-15(26-8-27-18)4-11(21)7-25-17/h4-10H,1-3H3,(H2,24,29)(H,26,27,28)/t9-,10?,20+/m1/s1 |
| InChIKey | XKOVZBOCDUGRCA-SFENZRFHSA-N |
| XLogP | 4.49 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |