C26H28N4O5 — CID 118885081
N-ethyl-3-[5-hydroxy-9-methyl-15-(4-methylphenyl)-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-9-yl]propanamide (PubChem CID 118885081) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-ethyl-3-[5-hydroxy-9-methyl-15-(4-methylphenyl)-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-9-yl]propanamide.
| Compound Name | N-ethyl-3-[5-hydroxy-9-methyl-15-(4-methylphenyl)-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-9-yl]propanamide |
|---|---|
| PubChem CID | 118885081 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-ethyl-3-[5-hydroxy-9-methyl-15-(4-methylphenyl)-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-9-yl]propanamide |
| SMILES | CCNC(=O)CCC1(C)Oc2cc(O)ccc2C2C1=CCn1c(=O)n(-c3ccc(C)cc3)c(=O)n12 |
| InChI | InChI=1S/C26H28N4O5/c1-4-27-22(32)11-13-26(3)20-12-14-28-24(33)29(17-7-5-16(2)6-8-17)25(34)30(28)23(20)19-10-9-18(31)15-21(19)35-26/h5-10,12,15,23,31H,4,11,13-14H2,1-3H3,(H,27,32) |
| InChIKey | RIWMCBXNASJADY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|