C15H28O4S2 — CID 118885693
(4S,5R)-4-[bis(ethylsulfanyl)methyl]-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 118885693) has the molecular formula C15H28O4S2 and a molecular weight of 336.52 g/mol. Its IUPAC name is (4S,5R)-4-[bis(ethylsulfanyl)methyl]-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[bis(ethylsulfanyl)methyl]-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 118885693 |
| Molecular Formula | C15H28O4S2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (4S,5R)-4-[bis(ethylsulfanyl)methyl]-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCSC(SCC)[C@H]1OC(C)(C)O[C@@H]1C1COC(C)(C)O1 |
| InChI | InChI=1S/C15H28O4S2/c1-7-20-13(21-8-2)12-11(18-15(5,6)19-12)10-9-16-14(3,4)17-10/h10-13H,7-9H2,1-6H3/t10?,11-,12+/m1/s1 |
| InChIKey | AQOSDHFQHXQKBE-SAIIYOCFSA-N |
| XLogP | 3.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|