C9H10F7NO3S2 — CID 11888610
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetamide (PubChem CID 11888610) has the molecular formula C9H10F7NO3S2 and a molecular weight of 377.30 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 11888610 |
| Molecular Formula | C9H10F7NO3S2 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)acetamide |
| SMILES | O=C(CSC(F)(F)C(F)(F)C(F)(F)F)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H10F7NO3S2/c10-7(11,8(12,13)14)9(15,16)21-3-6(18)17-5-1-2-22(19,20)4-5/h5H,1-4H2,(H,17,18)/t5-/m0/s1 |
| InChIKey | YWYXMMHFUYUQTL-YFKPBYRVSA-N |
| XLogP | 1.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|