C17H26F4O10S2 — CID 118886338
propan-2-yl 4,4-bis[(1,1-difluoro-2-oxo-2-propan-2-yloxyethyl)sulfonyl]butanoate (PubChem CID 118886338) has the molecular formula C17H26F4O10S2 and a molecular weight of 530.51 g/mol. Its IUPAC name is propan-2-yl 4,4-bis[(1,1-difluoro-2-oxo-2-propan-2-yloxyethyl)sulfonyl]butanoate.
| Compound Name | propan-2-yl 4,4-bis[(1,1-difluoro-2-oxo-2-propan-2-yloxyethyl)sulfonyl]butanoate |
|---|---|
| PubChem CID | 118886338 |
| Molecular Formula | C17H26F4O10S2 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | propan-2-yl 4,4-bis[(1,1-difluoro-2-oxo-2-propan-2-yloxyethyl)sulfonyl]butanoate |
| SMILES | CC(C)OC(=O)CCC(S(=O)(=O)C(F)(F)C(=O)OC(C)C)S(=O)(=O)C(F)(F)C(=O)OC(C)C |
| InChI | InChI=1S/C17H26F4O10S2/c1-9(2)29-12(22)7-8-13(32(25,26)16(18,19)14(23)30-10(3)4)33(27,28)17(20,21)15(24)31-11(5)6/h9-11,13H,7-8H2,1-6H3 |
| InChIKey | MAFWQAGMVSRZJU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|