C26H20N4O6S — CID 1188866
N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 1188866) has the molecular formula C26H20N4O6S and a molecular weight of 516.54 g/mol. Its IUPAC name is N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 1188866 |
| Molecular Formula | C26H20N4O6S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(N4C(=O)c5ccccc5C4=O)cc3)cc2)c1C |
| InChI | InChI=1S/C26H20N4O6S/c1-15-16(2)28-36-24(15)29-37(34,35)20-13-9-18(10-14-20)27-23(31)17-7-11-19(12-8-17)30-25(32)21-5-3-4-6-22(21)26(30)33/h3-14,29H,1-2H3,(H,27,31) |
| InChIKey | ZAZNXMDAEGJOJO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|