C21H26F3NO10 — CID 118886791
5-acetamido-4-hydroxy-2-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 118886791) has the molecular formula C21H26F3NO10 and a molecular weight of 509.43 g/mol. Its IUPAC name is 5-acetamido-4-hydroxy-2-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | 5-acetamido-4-hydroxy-2-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 118886791 |
| Molecular Formula | C21H26F3NO10 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 5-acetamido-4-hydroxy-2-[4-(4,4,4-trifluoro-3-oxobutyl)phenoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)NC1C(O)CC(Oc2ccc(CCC(=O)C(F)(F)F)cc2)(C(=O)O)OC1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C21H26F3NO10/c1-10(27)25-16-13(28)8-20(19(32)33,35-18(16)17(31)14(29)9-26)34-12-5-2-11(3-6-12)4-7-15(30)21(22,23)24/h2-3,5-6,13-14,16-18,26,28-29,31H,4,7-9H2,1H3,(H,25,27)(H,32,33)/t13?,14-,16?,17-,18?,20?/m1/s1 |
| InChIKey | GCLKXMDNHSBCKR-DLKDFORTSA-N |
| XLogP | -0.72 |
| TPSA | 182.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |