About 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine
4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine (PubChem CID 118887662) has the molecular formula C16H33NS
and a molecular weight of 271.51 g/mol. Its IUPAC name is 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine.
Molecular Properties
| Compound Name | 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine |
| PubChem CID | 118887662 |
| Molecular Formula | C16H33NS |
| Molecular Weight | 271.51 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine |
| SMILES | CCC(CCCN1CCSCC1)CCC(C)(C)C |
| InChI | InChI=1S/C16H33NS/c1-5-15(8-9-16(2,3)4)7-6-10-17-11-13-18-14-12-17/h15H,5-14H2,1-4H3 |
| InChIKey | LFAQQBCTHHSDQL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine?
The IUPAC name of 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine (CID 118887662) is 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine.
What is the SMILES notation for 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine?
The canonical SMILES for 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine is CCC(CCCN1CCSCC1)CCC(C)(C)C.
What is the InChIKey of 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine?
The InChIKey is LFAQQBCTHHSDQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NS/c1-5-15(8-9-16(2,3)4)7-6-10-17-11-13-18-14-12-17/h15H,5-14H2,1-4H3.
What are the key properties of 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine?
4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine has a molecular weight of 271.51 g/mol, XLogP of 4.67, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4S)-4-ethyl-7,7-dimethyloctyl]thiomorpholine is sourced from PubChem (CID 118887662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).