About (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine
(6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine (PubChem CID 118887834) has the molecular formula C19H41NO
and a molecular weight of 299.54 g/mol. Its IUPAC name is (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine.
Molecular Properties
| Compound Name | (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine |
| PubChem CID | 118887834 |
| Molecular Formula | C19H41NO |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.32 |
| IUPAC Name | (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine |
| SMILES | COCC[C@H](CCCCCNCC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C19H41NO/c1-18(2,3)15-17(12-14-21-7)11-9-8-10-13-20-16-19(4,5)6/h17,20H,8-16H2,1-7H3/t17-/m0/s1 |
| InChIKey | FRRQLVVRKXIFTG-KRWDZBQOSA-N |
| XLogP | 5.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine?
The IUPAC name of (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine (CID 118887834) is (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine.
What is the SMILES notation for (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine?
The canonical SMILES for (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine is COCC[C@H](CCCCCNCC(C)(C)C)CC(C)(C)C.
What is the InChIKey of (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine?
The InChIKey is FRRQLVVRKXIFTG-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H41NO/c1-18(2,3)15-17(12-14-21-7)11-9-8-10-13-20-16-19(4,5)6/h17,20H,8-16H2,1-7H3/t17-/m0/s1.
What are the key properties of (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine?
(6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine has a molecular weight of 299.54 g/mol, XLogP of 5.27, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-N-(2,2-dimethylpropyl)-6-(2-methoxyethyl)-8,8-dimethylnonan-1-amine is sourced from PubChem (CID 118887834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).