About 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one
1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 118888622) has the molecular formula C17H19N5O
and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one |
| PubChem CID | 118888622 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | Nc1ccc(N2CCC(n3c(=O)[nH]c4ncccc43)CC2)cc1 |
| InChI | InChI=1S/C17H19N5O/c18-12-3-5-13(6-4-12)21-10-7-14(8-11-21)22-15-2-1-9-19-16(15)20-17(22)23/h1-6,9,14H,7-8,10-11,18H2,(H,19,20,23) |
| InChIKey | SNZDCNDPKAKDCV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one?
The IUPAC name of 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one (CID 118888622) is 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one is Nc1ccc(N2CCC(n3c(=O)[nH]c4ncccc43)CC2)cc1.
What is the InChIKey of 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one?
The InChIKey is SNZDCNDPKAKDCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O/c18-12-3-5-13(6-4-12)21-10-7-14(8-11-21)22-15-2-1-9-19-16(15)20-17(22)23/h1-6,9,14H,7-8,10-11,18H2,(H,19,20,23).
What are the key properties of 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one?
1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one has a molecular weight of 309.37 g/mol, XLogP of 2.15, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-aminophenyl)piperidin-4-yl]-3H-imidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 118888622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).