C32H40F3N9O2S2 — CID 118888687
4-[2-[2-cyano-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indol-1-yl]ethyl]-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 118888687) has the molecular formula C32H40F3N9O2S2 and a molecular weight of 703.86 g/mol. Its IUPAC name is 4-[2-[2-cyano-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indol-1-yl]ethyl]-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-[2-[2-cyano-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indol-1-yl]ethyl]-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 118888687 |
| Molecular Formula | C32H40F3N9O2S2 |
| Molecular Weight | 703.86 g/mol |
| Exact Mass | 703.27 |
| IUPAC Name | 4-[2-[2-cyano-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indol-1-yl]ethyl]-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | Cc1c(CN2CCC(Nc3ncnc4sc(CC(F)(F)F)cc34)CC2)ccc2c1cc(C#N)n2CCN1CCN(S(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C32H40F3N9O2S2/c1-22-23(20-42-8-6-24(7-9-42)39-30-28-17-26(18-32(33,34)35)47-31(28)38-21-37-30)4-5-29-27(22)16-25(19-36)44(29)15-12-41-10-13-43(14-11-41)48(45,46)40(2)3/h4-5,16-17,21,24H,6-15,18,20H2,1-3H3,(H,37,38,39) |
| InChIKey | YYHKRKGMKFDAEP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |