About 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol
5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol (PubChem CID 118888976) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol |
| PubChem CID | 118888976 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol |
| SMILES | Nc1ccc2c(c1)OCCN2CCCCCO |
| InChI | InChI=1S/C13H20N2O2/c14-11-4-5-12-13(10-11)17-9-7-15(12)6-2-1-3-8-16/h4-5,10,16H,1-3,6-9,14H2 |
| InChIKey | GOZQAZTTZIWNMS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol?
The IUPAC name of 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol (CID 118888976) is 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol.
What is the SMILES notation for 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol?
The canonical SMILES for 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol is Nc1ccc2c(c1)OCCN2CCCCCO.
What is the InChIKey of 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol?
The InChIKey is GOZQAZTTZIWNMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c14-11-4-5-12-13(10-11)17-9-7-15(12)6-2-1-3-8-16/h4-5,10,16H,1-3,6-9,14H2.
What are the key properties of 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol?
5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol has a molecular weight of 236.31 g/mol, XLogP of 1.63, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-ol is sourced from PubChem (CID 118888976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).