About 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol
3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol (PubChem CID 118889008) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol |
| PubChem CID | 118889008 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol |
| SMILES | Cc1cc2c(cc1N)OCCN2CCCO |
| InChI | InChI=1S/C12H18N2O2/c1-9-7-11-12(8-10(9)13)16-6-4-14(11)3-2-5-15/h7-8,15H,2-6,13H2,1H3 |
| InChIKey | OBIADHVBGJTIGE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol?
The IUPAC name of 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol (CID 118889008) is 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol.
What is the SMILES notation for 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol?
The canonical SMILES for 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol is Cc1cc2c(cc1N)OCCN2CCCO.
What is the InChIKey of 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol?
The InChIKey is OBIADHVBGJTIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-9-7-11-12(8-10(9)13)16-6-4-14(11)3-2-5-15/h7-8,15H,2-6,13H2,1H3.
What are the key properties of 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol?
3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol has a molecular weight of 222.29 g/mol, XLogP of 1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-amino-6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-ol is sourced from PubChem (CID 118889008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).