About 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide
6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide (PubChem CID 118889039) has the molecular formula C14H18BrF2NO
and a molecular weight of 334.20 g/mol. Its IUPAC name is 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide.
Molecular Properties
| Compound Name | 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide |
| PubChem CID | 118889039 |
| Molecular Formula | C14H18BrF2NO |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide |
| SMILES | CN(C)C(=O)CCCCCc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C14H18BrF2NO/c1-18(2)14(19)7-5-3-4-6-10-8-13(17)11(15)9-12(10)16/h8-9H,3-7H2,1-2H3 |
| InChIKey | QKGGQDVROQTOJR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide?
The IUPAC name of 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide (CID 118889039) is 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide.
What is the SMILES notation for 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide?
The canonical SMILES for 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide is CN(C)C(=O)CCCCCc1cc(F)c(Br)cc1F.
What is the InChIKey of 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide?
The InChIKey is QKGGQDVROQTOJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrF2NO/c1-18(2)14(19)7-5-3-4-6-10-8-13(17)11(15)9-12(10)16/h8-9H,3-7H2,1-2H3.
What are the key properties of 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide?
6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide has a molecular weight of 334.20 g/mol, XLogP of 3.92, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-bromo-2,5-difluorophenyl)-N,N-dimethylhexanamide is sourced from PubChem (CID 118889039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).