C15H20O2 — CID 118889074
6-hydroxy-2,4,4-trimethyl-3-[(1E,3E)-3-methylpenta-1,3-dienyl]cyclohexa-2,5-dien-1-one (PubChem CID 118889074) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 6-hydroxy-2,4,4-trimethyl-3-[(1E,3E)-3-methylpenta-1,3-dienyl]cyclohexa-2,5-dien-1-one.
| Compound Name | 6-hydroxy-2,4,4-trimethyl-3-[(1E,3E)-3-methylpenta-1,3-dienyl]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 118889074 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 6-hydroxy-2,4,4-trimethyl-3-[(1E,3E)-3-methylpenta-1,3-dienyl]cyclohexa-2,5-dien-1-one |
| SMILES | C/C=C(C)/C=C/C1=C(C)C(=O)C(O)=CC1(C)C |
| InChI | InChI=1S/C15H20O2/c1-6-10(2)7-8-12-11(3)14(17)13(16)9-15(12,4)5/h6-9,16H,1-5H3/b8-7+,10-6+ |
| InChIKey | ROACTPQKKGYWKP-IQXTZUCASA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|