C22H32ClF3N4O4S — CID 118889122
N-[4-[[(3aR,4S,6R,6aS)-4-butoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-methylamino]-6-chloro-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide (PubChem CID 118889122) has the molecular formula C22H32ClF3N4O4S and a molecular weight of 541.04 g/mol. Its IUPAC name is N-[4-[[(3aR,4S,6R,6aS)-4-butoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-methylamino]-6-chloro-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[[(3aR,4S,6R,6aS)-4-butoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-methylamino]-6-chloro-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 118889122 |
| Molecular Formula | C22H32ClF3N4O4S |
| Molecular Weight | 541.04 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | N-[4-[[(3aR,4S,6R,6aS)-4-butoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-methylamino]-6-chloro-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCO[C@H]1C[C@@H](N(C)c2nc(SCCC)nc(Cl)c2NC(=O)C(F)(F)F)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C22H32ClF3N4O4S/c1-6-8-9-32-13-11-12(15-16(13)34-21(3,4)33-15)30(5)18-14(27-19(31)22(24,25)26)17(23)28-20(29-18)35-10-7-2/h12-13,15-16H,6-11H2,1-5H3,(H,27,31)/t12-,13+,15+,16-/m1/s1 |
| InChIKey | NGRWCJASTVEFPC-BFJAYTPKSA-N |
| XLogP | 5.05 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.04 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|