C16H22ClF3N4O5S — CID 118889127
N-[4-chloro-6-[[(1R,2S,3S,4S)-2,3-dihydroxy-4-(2-hydroxyethoxy)cyclopentyl]amino]-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide (PubChem CID 118889127) has the molecular formula C16H22ClF3N4O5S and a molecular weight of 474.89 g/mol. Its IUPAC name is N-[4-chloro-6-[[(1R,2S,3S,4S)-2,3-dihydroxy-4-(2-hydroxyethoxy)cyclopentyl]amino]-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-chloro-6-[[(1R,2S,3S,4S)-2,3-dihydroxy-4-(2-hydroxyethoxy)cyclopentyl]amino]-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 118889127 |
| Molecular Formula | C16H22ClF3N4O5S |
| Molecular Weight | 474.89 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[4-chloro-6-[[(1R,2S,3S,4S)-2,3-dihydroxy-4-(2-hydroxyethoxy)cyclopentyl]amino]-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCCSc1nc(Cl)c(NC(=O)C(F)(F)F)c(N[C@@H]2C[C@H](OCCO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C16H22ClF3N4O5S/c1-2-5-30-15-23-12(17)9(22-14(28)16(18,19)20)13(24-15)21-7-6-8(29-4-3-25)11(27)10(7)26/h7-8,10-11,25-27H,2-6H2,1H3,(H,22,28)(H,21,23,24)/t7-,8+,10+,11-/m1/s1 |
| InChIKey | DAHCXXNZOJUUTO-YKDSUIRESA-N |
| XLogP | 1.42 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.89 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |