C12H14I2N2O2S — CID 118889134
1-[2-[4-(1,1-diiodoethyl)-1,3-thiazol-2-yl]ethyl]piperidine-2,6-dione (PubChem CID 118889134) has the molecular formula C12H14I2N2O2S and a molecular weight of 504.13 g/mol. Its IUPAC name is 1-[2-[4-(1,1-diiodoethyl)-1,3-thiazol-2-yl]ethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-[4-(1,1-diiodoethyl)-1,3-thiazol-2-yl]ethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 118889134 |
| Molecular Formula | C12H14I2N2O2S |
| Molecular Weight | 504.13 g/mol |
| Exact Mass | 503.89 |
| IUPAC Name | 1-[2-[4-(1,1-diiodoethyl)-1,3-thiazol-2-yl]ethyl]piperidine-2,6-dione |
| SMILES | CC(I)(I)c1csc(CCN2C(=O)CCCC2=O)n1 |
| InChI | InChI=1S/C12H14I2N2O2S/c1-12(13,14)8-7-19-9(15-8)5-6-16-10(17)3-2-4-11(16)18/h7H,2-6H2,1H3 |
| InChIKey | DIPZWXWJIBPEKK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|